cas: 2828459-32-9 — see every product listed under this CAS number, including other names
6'-Bromospiro[cyclopropane-1,3'-isochromane]-8'-carbaldehyde 98% (CAS 2828459-32-9) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1730281-5mg |
| cas | 2828459-32-9 |
| size | 5mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 565.06 Pln | |
| Ambeed | 10mg | 848.75 Pln | |
| Ambeed | 25mg | 1549.62 Pln | |
| Ambeed | 50mg | 2573.12 Pln | |
| Ambeed | 100mg | 4319.75 Pln | |
| Ambeed | 250mg | 7712.88 Pln | |
| Ambeed | 1g | 24522.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1730281 |
6-bromospiro[1,4-dihydroisochromene-3,1'-cyclopropane]-8-carbaldehyde (CAS 2828459-32-9) is a chemical compound with the molecular formula C12H11BrO2 and a molecular weight of 267.12 g/mol. IUPAC name: 6-bromospiro[1,4-dihydroisochromene-3,1'-cyclopropane]-8-carbaldehyde. InChIKey: SEHJDNSSTSXZJJ-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO2 |
|---|---|
| Molecular weight | 267.12 g/mol |
| IUPAC name | 6-bromospiro[1,4-dihydroisochromene-3,1'-cyclopropane]-8-carbaldehyde |
| InChIKey | SEHJDNSSTSXZJJ-UHFFFAOYSA-N |
| SMILES | C1CC12CC3=C(CO2)C(=CC(=C3)Br)C=O |
Computed by PubChem (NCBI)