CAS 64648-81-3 appears in our catalog under these names: 2-Bromo-1,4-dimethoxynaphthalene, 95%, 2-Bromo-1,4-dimethoxynaphthalene, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
2-bromo-1,4-dimethoxynaphthalene (CAS 64648-81-3) is a chemical compound with the molecular formula C12H11BrO2 and a molecular weight of 267.12 g/mol. IUPAC name: 2-bromo-1,4-dimethoxynaphthalene. InChIKey: CUDFWADTRPHTIQ-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO2 |
|---|---|
| Molecular weight | 267.12 g/mol |
| IUPAC name | 2-bromo-1,4-dimethoxynaphthalene |
| InChIKey | CUDFWADTRPHTIQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C2=CC=CC=C21)OC)Br |
Computed by PubChem (NCBI)