Products 500778-20-1
CAS 500778-20-1 is the registry number for 2-Bromo-3,4-dihydronaphthalen-1-yl acetate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
(2-bromo-3,4-dihydronaphthalen-1-yl) acetate (CAS 500778-20-1) is a chemical compound with the molecular formula C12H11BrO2 and a molecular weight of 267.12 g/mol. IUPAC name: (2-bromo-3,4-dihydronaphthalen-1-yl) acetate. InChIKey: XRRWXQUVPWRGFI-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO2 |
|---|---|
| Molecular weight | 267.12 g/mol |
| IUPAC name | (2-bromo-3,4-dihydronaphthalen-1-yl) acetate |
| InChIKey | XRRWXQUVPWRGFI-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(CCC2=CC=CC=C21)Br |
Computed by PubChem (NCBI)