Products 1980054-39-4
CAS 1980054-39-4 appears in our catalog under these names: 3-(4-Bromophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid, 95%, 3-(4-Bromophenyl)bicyclo(1.1.1)pentane-1-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 500mg, 1000mg.
3-(4-bromophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 1980054-39-4) is a chemical compound with the molecular formula C12H11BrO2 and a molecular weight of 267.12 g/mol. IUPAC name: 3-(4-bromophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: ULOMEMOEJASGAP-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO2 |
|---|---|
| Molecular weight | 267.12 g/mol |
| IUPAC name | 3-(4-bromophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | ULOMEMOEJASGAP-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)C(=O)O)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)