CAS 4614-11-3 appears in our catalog under these names: 1-Bromo-2,7-dimethoxynaphthalene, 98%, 1-Bromo-2,7-dimethoxynaphthalene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-bromo-2,7-dimethoxynaphthalene (CAS 4614-11-3) is a chemical compound with the molecular formula C12H11BrO2 and a molecular weight of 267.12 g/mol. IUPAC name: 1-bromo-2,7-dimethoxynaphthalene. InChIKey: SJWOLBKUHCXXNM-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO2 |
|---|---|
| Molecular weight | 267.12 g/mol |
| IUPAC name | 1-bromo-2,7-dimethoxynaphthalene |
| InChIKey | SJWOLBKUHCXXNM-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=CC(=C2Br)OC |
Computed by PubChem (NCBI)