CAS 913718-17-9 is the registry number for 2-Bromo-5-phenylcyclohexane-1,3-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-bromo-5-phenylcyclohexane-1,3-dione (CAS 913718-17-9) is a chemical compound with the molecular formula C12H11BrO2 and a molecular weight of 267.12 g/mol. IUPAC name: 2-bromo-5-phenylcyclohexane-1,3-dione. InChIKey: PZMBPUUXXSWXEW-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO2 |
|---|---|
| Molecular weight | 267.12 g/mol |
| IUPAC name | 2-bromo-5-phenylcyclohexane-1,3-dione |
| InChIKey | PZMBPUUXXSWXEW-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)C(C1=O)Br)C2=CC=CC=C2 |
Computed by PubChem (NCBI)