CAS 239132-48-0 appears in our catalog under these names: 5-(4-Bromophenyl)cyclohexane-1,3-dione, 95%, 5-(4-Bromophenyl)cyclohexane-1,3-dione 95%, 5-(4-Bromophenyl)cyclohexane-1,3-dione, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
5-(4-bromophenyl)cyclohexane-1,3-dione (CAS 239132-48-0) is a chemical compound with the molecular formula C12H11BrO2 and a molecular weight of 267.12 g/mol. IUPAC name: 5-(4-bromophenyl)cyclohexane-1,3-dione. InChIKey: GQCQFGJLUYXUAG-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO2 |
|---|---|
| Molecular weight | 267.12 g/mol |
| IUPAC name | 5-(4-bromophenyl)cyclohexane-1,3-dione |
| InChIKey | GQCQFGJLUYXUAG-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)CC1=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)