Products 2828459-32-9
CAS 2828459-32-9 appears in our catalog under these names: 6'-Bromospiro[cyclopropane-1,3'-isochromane]-8'-carbaldehyde, 95%, 6'-Bromospiro[cyclopropane-1,3'-isochromane]-8'-carbaldehyde 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
6-bromospiro[1,4-dihydroisochromene-3,1'-cyclopropane]-8-carbaldehyde (CAS 2828459-32-9) is a chemical compound with the molecular formula C12H11BrO2 and a molecular weight of 267.12 g/mol. IUPAC name: 6-bromospiro[1,4-dihydroisochromene-3,1'-cyclopropane]-8-carbaldehyde. InChIKey: SEHJDNSSTSXZJJ-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO2 |
|---|---|
| Molecular weight | 267.12 g/mol |
| IUPAC name | 6-bromospiro[1,4-dihydroisochromene-3,1'-cyclopropane]-8-carbaldehyde |
| InChIKey | SEHJDNSSTSXZJJ-UHFFFAOYSA-N |
| SMILES | C1CC12CC3=C(CO2)C(=CC(=C3)Br)C=O |
Computed by PubChem (NCBI)