cas: 383132-13-6 — see every product listed under this CAS number, including other names
6,7-Dichloro-1H-indole-2-carboxylic acid, 95% (CAS 383132-13-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F635918-250MG |
| cas | 383132-13-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 846.59 Pln | |
| Fluorochem | 5g | 2424.16 Pln | |
| Fluorochem | 10g | 4194.37 Pln | |
| Fluorochem | 25g | 8338.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
6,7-dichloro-1H-indole-2-carboxylic acid (CAS 383132-13-6) is a chemical compound with the molecular formula C9H5Cl2NO2 and a molecular weight of 230.04 g/mol. IUPAC name: 6,7-dichloro-1H-indole-2-carboxylic acid. InChIKey: TUXCSCQQWQOWDU-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 6,7-dichloro-1H-indole-2-carboxylic acid |
| InChIKey | TUXCSCQQWQOWDU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=C(N2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)