cas: 1211529-86-0 — see every product listed under this CAS number, including other names
6-(1,1-Difluoroethyl)picolinic acid, 95%, 95% (CAS 1211529-86-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ILDV-50mg |
| cas | 1211529-86-0 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 410.00 Pln | |
| Chemat | 100mg | 640.40 Pln | |
| Chemat | 250mg | 1230.80 Pln | |
| Chemat | 1g | 3002.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-(1,1-difluoroethyl)pyridine-2-carboxylic acid (CAS 1211529-86-0) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: 6-(1,1-difluoroethyl)pyridine-2-carboxylic acid. InChIKey: RSIRTUDFDFJYAW-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | 6-(1,1-difluoroethyl)pyridine-2-carboxylic acid |
| InChIKey | RSIRTUDFDFJYAW-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC(=N1)C(=O)O)(F)F |
Computed by PubChem (NCBI)