cas: 725256-57-5 — see every product listed under this CAS number, including other names
6-(Benzyloxy)pyridin-3-ol 98% (CAS 725256-57-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A153122-250mg |
| cas | 725256-57-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 342.56 Pln | |
| Ambeed | 10g | 537.25 Pln | |
| Ambeed | 25g | 1232.56 Pln | |
| Ambeed | 100g | 4709.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A153122 |
6-phenylmethoxypyridin-3-ol (CAS 725256-57-5) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 6-phenylmethoxypyridin-3-ol. InChIKey: VKPWAEVWZUALPZ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 6-phenylmethoxypyridin-3-ol |
| InChIKey | VKPWAEVWZUALPZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC=C(C=C2)O |
Computed by PubChem (NCBI)