cas: 17874-76-9 — see every product listed under this CAS number, including other names
6-(Methoxycarbonyl)nicotinic acid, 96% (CAS 17874-76-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F066880-25G |
| cas | 17874-76-9 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 2497.06 Pln | |
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 643.54 Pln | |
| Fluorochem | 10g | 1205.84 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
6-methoxycarbonylpyridine-3-carboxylic acid (CAS 17874-76-9) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 6-methoxycarbonylpyridine-3-carboxylic acid. InChIKey: QRSXLMSDECGEOU-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 6-methoxycarbonylpyridine-3-carboxylic acid |
| InChIKey | QRSXLMSDECGEOU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)