cas: 17874-76-9 — see every product listed under this CAS number, including other names
6-(Methoxycarbonyl)pyridine-3-carboxylic Acid, 96%, 96% (CAS 17874-76-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11370Q-100mg |
| cas | 17874-76-9 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 371.60 Pln | |
| Chemat | 10g | 626.00 Pln | |
| Chemat | 25g | 1442.00 Pln | |
| Chemat | 50g | 2613.20 Pln | |
| Chemat | 100g | 4749.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
6-methoxycarbonylpyridine-3-carboxylic acid (CAS 17874-76-9) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 6-methoxycarbonylpyridine-3-carboxylic acid. InChIKey: QRSXLMSDECGEOU-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 6-methoxycarbonylpyridine-3-carboxylic acid |
| InChIKey | QRSXLMSDECGEOU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)