CAS 162252-92-8 appears in our catalog under these names: 6–(Trifluoromethoxy)isatin, 6-(Trifluoromethoxy)isatin, 97%, 97%, 6-(Trifluoromethoxy)indoline-2,3-dione, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
6-(trifluoromethoxy)-1H-indole-2,3-dione (CAS 162252-92-8) is a chemical compound with the molecular formula C9H4F3NO3 and a molecular weight of 231.13 g/mol. IUPAC name: 6-(trifluoromethoxy)-1H-indole-2,3-dione. InChIKey: NHPRQRZWXLBANJ-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO3 |
|---|---|
| Molecular weight | 231.13 g/mol |
| IUPAC name | 6-(trifluoromethoxy)-1H-indole-2,3-dione |
| InChIKey | NHPRQRZWXLBANJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OC(F)(F)F)NC(=O)C2=O |
Computed by PubChem (NCBI)