Products 1805465-50-2

CAS 1805465-50-2 is the registry number for 4-Cyano-2-(trifluoromethoxy)benzoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-cyano-2-(trifluoromethoxy)benzoic acid (CAS 1805465-50-2) is a chemical compound with the molecular formula C9H4F3NO3 and a molecular weight of 231.13 g/mol. IUPAC name: 4-cyano-2-(trifluoromethoxy)benzoic acid. InChIKey: DLGJAGKIYCTWTO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H4F3NO3
Molecular weight231.13 g/mol
IUPAC name4-cyano-2-(trifluoromethoxy)benzoic acid
InChIKeyDLGJAGKIYCTWTO-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C#N)OC(F)(F)F)C(=O)O

Computed by PubChem (NCBI)