CAS 1181288-08-3 appears in our catalog under these names: 2-(Trifluoromethyl)-1,3-benzoxazole-6-carboxylic acid, 95%, 2-(Trifluoromethyl)-1,3-benzoxazole-6-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(trifluoromethyl)-1,3-benzoxazole-6-carboxylic acid (CAS 1181288-08-3) is a chemical compound with the molecular formula C9H4F3NO3 and a molecular weight of 231.13 g/mol. IUPAC name: 2-(trifluoromethyl)-1,3-benzoxazole-6-carboxylic acid. InChIKey: FNGMUVHYSMEONK-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO3 |
|---|---|
| Molecular weight | 231.13 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1,3-benzoxazole-6-carboxylic acid |
| InChIKey | FNGMUVHYSMEONK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)OC(=N2)C(F)(F)F |
Computed by PubChem (NCBI)