CAS 72985-50-3 appears in our catalog under these names: 8-(trifluoromethyl)-1H-3,1-benzoxazine-2,4-dione, 95%, 8-(Trifluoromethyl)-2H-benzo[d][1,3]oxazine-2,4(1H)-dione, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
8-(trifluoromethyl)-1H-3,1-benzoxazine-2,4-dione (CAS 72985-50-3) is a chemical compound with the molecular formula C9H4F3NO3 and a molecular weight of 231.13 g/mol. IUPAC name: 8-(trifluoromethyl)-1H-3,1-benzoxazine-2,4-dione. InChIKey: FWLOMSMDWVUGDL-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO3 |
|---|---|
| Molecular weight | 231.13 g/mol |
| IUPAC name | 8-(trifluoromethyl)-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | FWLOMSMDWVUGDL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(F)(F)F)NC(=O)OC2=O |
Computed by PubChem (NCBI)