Products 1807046-75-8

CAS 1807046-75-8 is the registry number for 3-Cyano-2-(trifluoromethoxy)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-cyano-2-(trifluoromethoxy)benzoic acid (CAS 1807046-75-8) is a chemical compound with the molecular formula C9H4F3NO3 and a molecular weight of 231.13 g/mol. IUPAC name: 3-cyano-2-(trifluoromethoxy)benzoic acid. InChIKey: UKJWAJZHRCMMOW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H4F3NO3
Molecular weight231.13 g/mol
IUPAC name3-cyano-2-(trifluoromethoxy)benzoic acid
InChIKeyUKJWAJZHRCMMOW-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)C(=O)O)OC(F)(F)F)C#N

Computed by PubChem (NCBI)