Products 453565-91-8
CAS 453565-91-8 appears in our catalog under these names: 3–Cyano–5–(trifluoromethoxy)benzoic acid, 3-Cyano-5-(trifluoromethoxy)benzoic acid 95%, 3-Cyano-5-(trifluoromethoxy)benzoic acid, 95%, 95%, 3-Cyano-5-(trifluoromethoxy)benzoic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
3-cyano-5-(trifluoromethoxy)benzoic acid (CAS 453565-91-8) is a chemical compound with the molecular formula C9H4F3NO3 and a molecular weight of 231.13 g/mol. IUPAC name: 3-cyano-5-(trifluoromethoxy)benzoic acid. InChIKey: LPTVJUYLMCVVAO-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO3 |
|---|---|
| Molecular weight | 231.13 g/mol |
| IUPAC name | 3-cyano-5-(trifluoromethoxy)benzoic acid |
| InChIKey | LPTVJUYLMCVVAO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)OC(F)(F)F)C#N |
Computed by PubChem (NCBI)