CAS 781-94-2 appears in our catalog under these names: 6-(Trifluoromethyl)-2,4-dihydro-1h-3,1-benzoxazine-2,4-dione, 98%, 6-(Trifluoromethyl)-2,4-dihydro-1H-3,1-benzoxazine-2,4-dione, 6-(Trifluoromethyl)-1H-benzo[d][1,3]oxazine-2,4-dione 97%, 6-(Trifluoromethyl)-1H-benzo[d][1,3]oxazine-2,4-dione, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 0,5g.
6-(trifluoromethyl)-1H-3,1-benzoxazine-2,4-dione (CAS 781-94-2) is a chemical compound with the molecular formula C9H4F3NO3 and a molecular weight of 231.13 g/mol. IUPAC name: 6-(trifluoromethyl)-1H-3,1-benzoxazine-2,4-dione. InChIKey: HAMDXJUAHDROHP-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO3 |
|---|---|
| Molecular weight | 231.13 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | HAMDXJUAHDROHP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)