CAS 149125-30-4 appears in our catalog under these names: 7-Trifluoromethoxyisatin 97%, 7-Trifluoromethoxyisatin, 97%, 97%, 7-Trifluoromethoxyisatin, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg.
7-(trifluoromethoxy)-1H-indole-2,3-dione (CAS 149125-30-4) is a chemical compound with the molecular formula C9H4F3NO3 and a molecular weight of 231.13 g/mol. IUPAC name: 7-(trifluoromethoxy)-1H-indole-2,3-dione. InChIKey: JDVUYYNGNVYMKQ-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO3 |
|---|---|
| Molecular weight | 231.13 g/mol |
| IUPAC name | 7-(trifluoromethoxy)-1H-indole-2,3-dione |
| InChIKey | JDVUYYNGNVYMKQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)OC(F)(F)F)NC(=O)C2=O |
Computed by PubChem (NCBI)