cas: 20332-16-5 — see every product listed under this CAS number, including other names
6-Aminobenzo[d][1,3]dioxole-5-carboxylic acid 97% (CAS 20332-16-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A122098-100mg |
| cas | 20332-16-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1749.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A122098 |
6-amino-1,3-benzodioxole-5-carboxylic acid (CAS 20332-16-5) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 6-amino-1,3-benzodioxole-5-carboxylic acid. InChIKey: OJTOAMSTANUUMJ-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 6-amino-1,3-benzodioxole-5-carboxylic acid |
| InChIKey | OJTOAMSTANUUMJ-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)C(=O)O)N |
Computed by PubChem (NCBI)