CAS 1914179-49-9 appears in our catalog under these names: Deferasirox Impurity 23, E-4-Amino-3-((4- carboxylphenyl)diazenyl)benzoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5g.
4-amino-3-[(4-carboxyphenyl)diazenyl]benzoic acid (CAS 1914179-49-9) is a chemical compound with the molecular formula C14H11N3O4 and a molecular weight of 285.25 g/mol. IUPAC name: 4-amino-3-[(4-carboxyphenyl)diazenyl]benzoic acid. InChIKey: SMCWQOPFLNGYBQ-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O4 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | 4-amino-3-[(4-carboxyphenyl)diazenyl]benzoic acid |
| InChIKey | SMCWQOPFLNGYBQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N=NC2=C(C=CC(=C2)C(=O)O)N |
Computed by PubChem (NCBI)