CAS 1801270-07-4 is the registry number for 3-((1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl)methyl)-1-methyl-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-[(1,3-dioxoisoindol-2-yl)methyl]-1-methylpyrazole-4-carboxylic acid (CAS 1801270-07-4) is a chemical compound with the molecular formula C14H11N3O4 and a molecular weight of 285.25 g/mol. IUPAC name: 3-[(1,3-dioxoisoindol-2-yl)methyl]-1-methylpyrazole-4-carboxylic acid. InChIKey: BKSSCQWZROKDJG-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O4 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-1-methylpyrazole-4-carboxylic acid |
| InChIKey | BKSSCQWZROKDJG-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)CN2C(=O)C3=CC=CC=C3C2=O)C(=O)O |
Computed by PubChem (NCBI)