CAS 120101-66-8 appears in our catalog under these names: 7-Nitro-4-(pyridin-2-ylmethyl)-2h-benzo[b][1,4]oxazin-3(4h)-one, 95%, 7–nitro–4–(pyridin–2–ylmethyl)–2H–benzo(b)(1,4)oxazin–3(4H)–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
7-nitro-4-(pyridin-2-ylmethyl)-1,4-benzoxazin-3-one (CAS 120101-66-8) is a chemical compound with the molecular formula C14H11N3O4 and a molecular weight of 285.25 g/mol. IUPAC name: 7-nitro-4-(pyridin-2-ylmethyl)-1,4-benzoxazin-3-one. InChIKey: BVXQKNPVJURLCC-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O4 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | 7-nitro-4-(pyridin-2-ylmethyl)-1,4-benzoxazin-3-one |
| InChIKey | BVXQKNPVJURLCC-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C2=C(O1)C=C(C=C2)[N+](=O)[O-])CC3=CC=CC=N3 |
Computed by PubChem (NCBI)