CAS 74169-56-5 is the registry number for 3,4–Dimethyl–1–(4–nitrophenyl)pyrano(2,3–c)pyrazol–6(1H)–one. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
3,4-dimethyl-1-(4-nitrophenyl)pyrano[3,2-d]pyrazol-6-one (CAS 74169-56-5) is a chemical compound with the molecular formula C14H11N3O4 and a molecular weight of 285.25 g/mol. IUPAC name: 3,4-dimethyl-1-(4-nitrophenyl)pyrano[3,2-d]pyrazol-6-one. InChIKey: XHPVUPLVVARPMC-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O4 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | 3,4-dimethyl-1-(4-nitrophenyl)pyrano[3,2-d]pyrazol-6-one |
| InChIKey | XHPVUPLVVARPMC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C(=NN2C3=CC=C(C=C3)[N+](=O)[O-])C |
Computed by PubChem (NCBI)