CAS 1410555-93-9 appears in our catalog under these names: 3-((1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl)methyl)furan-2-carbohydrazide, 95%, 3-((1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl)methyl)furan-2-carbohydrazide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-[(1,3-dioxoisoindol-2-yl)methyl]furan-2-carbohydrazide (CAS 1410555-93-9) is a chemical compound with the molecular formula C14H11N3O4 and a molecular weight of 285.25 g/mol. IUPAC name: 3-[(1,3-dioxoisoindol-2-yl)methyl]furan-2-carbohydrazide. InChIKey: YVEKEIULKSYMJG-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O4 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | 3-[(1,3-dioxoisoindol-2-yl)methyl]furan-2-carbohydrazide |
| InChIKey | YVEKEIULKSYMJG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC3=C(OC=C3)C(=O)NN |
Computed by PubChem (NCBI)