Products 5959-79-5

CAS 5959-79-5 is the registry number for 2-(1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl)-3-(1H-imidazol-5-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.

Structural formula: {0} (CAS {1})

2-(1,3-dioxoisoindol-2-yl)-3-(1H-imidazol-5-yl)propanoic acid (CAS 5959-79-5) is a chemical compound with the molecular formula C14H11N3O4 and a molecular weight of 285.25 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)-3-(1H-imidazol-5-yl)propanoic acid. InChIKey: CTUUVOUXZNQMSU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11N3O4
Molecular weight285.25 g/mol
IUPAC name2-(1,3-dioxoisoindol-2-yl)-3-(1H-imidazol-5-yl)propanoic acid
InChIKeyCTUUVOUXZNQMSU-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)N(C2=O)C(CC3=CN=CN3)C(=O)O

Computed by PubChem (NCBI)