CAS 5959-79-5 is the registry number for 2-(1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl)-3-(1H-imidazol-5-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
2-(1,3-dioxoisoindol-2-yl)-3-(1H-imidazol-5-yl)propanoic acid (CAS 5959-79-5) is a chemical compound with the molecular formula C14H11N3O4 and a molecular weight of 285.25 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)-3-(1H-imidazol-5-yl)propanoic acid. InChIKey: CTUUVOUXZNQMSU-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O4 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | 2-(1,3-dioxoisoindol-2-yl)-3-(1H-imidazol-5-yl)propanoic acid |
| InChIKey | CTUUVOUXZNQMSU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C(CC3=CN=CN3)C(=O)O |
Computed by PubChem (NCBI)