cas: 1036750-83-0 — see every product listed under this CAS number, including other names
6-Bromo-[1,1'-biphenyl]-3-amine, 98%, 98% (CAS 1036750-83-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1196GO-250mg |
| cas | 1036750-83-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 894.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-3-phenylaniline (CAS 1036750-83-0) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 4-bromo-3-phenylaniline. InChIKey: CZTUHSJLGKCOSC-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 4-bromo-3-phenylaniline |
| InChIKey | CZTUHSJLGKCOSC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC(=C2)N)Br |
Computed by PubChem (NCBI)