cas: 1036750-83-0 — see every product listed under this CAS number, including other names
6-Bromo-[1,1'-biphenyl]-3-amine, 98% (CAS 1036750-83-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211952-250MG |
| cas | 1036750-83-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 1450.55 Pln | |
| Fluorochem | 25g | 5725.09 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-3-phenylaniline (CAS 1036750-83-0) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 4-bromo-3-phenylaniline. InChIKey: CZTUHSJLGKCOSC-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 4-bromo-3-phenylaniline |
| InChIKey | CZTUHSJLGKCOSC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC(=C2)N)Br |
Computed by PubChem (NCBI)