cas: 406204-90-8 — see every product listed under this CAS number, including other names
6-Bromo-2,4-dichloroquinoline, 98%, 98% (CAS 406204-90-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CLML-100mg |
| cas | 406204-90-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 803.60 Pln | |
| Chemat | 25g | 2661.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-bromo-2,4-dichloroquinoline (CAS 406204-90-8) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 6-bromo-2,4-dichloroquinoline. InChIKey: CRFXLQFAIWSWIV-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 6-bromo-2,4-dichloroquinoline |
| InChIKey | CRFXLQFAIWSWIV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)