cas: 927801-17-0 — see every product listed under this CAS number, including other names
6-Bromo-3,4-dichloroquinoline, 97%, 97% (CAS 927801-17-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117E1V-250mg |
| cas | 927801-17-0 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 496.40 Pln | |
| Chemat | 1g | 1154.00 Pln | |
| Chemat | 5g | 3338.00 Pln | |
| Chemat | 10g | 5522.00 Pln | |
| Chemat | 25g | 10979.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-bromo-3,4-dichloroquinoline (CAS 927801-17-0) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 6-bromo-3,4-dichloroquinoline. InChIKey: HBDBPPHFTFARAO-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 6-bromo-3,4-dichloroquinoline |
| InChIKey | HBDBPPHFTFARAO-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C(=C2C=C1Br)Cl)Cl |
Computed by PubChem (NCBI)