CAS 723760-76-7 appears in our catalog under these names: 6-Bromo-5-methoxy-1-indanone, 95%, 6–Bromo–5–methoxy–2,3–dihydro–1H–inden–1–one, 6-Bromo-5-methoxy-2,3-dihydro-1H-inden-1-one, 6-Bromo-5-methoxy-2,3-dihydro-1H-inden-1-one, 95%, 95%, 6-Bromo-5-methoxy-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
6-bromo-5-methoxy-2,3-dihydroinden-1-one (CAS 723760-76-7) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 6-bromo-5-methoxy-2,3-dihydroinden-1-one. InChIKey: ZQZKRGKMOOQLMY-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 6-bromo-5-methoxy-2,3-dihydroinden-1-one |
| InChIKey | ZQZKRGKMOOQLMY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CCC2=O)Br |
Computed by PubChem (NCBI)