cas: 121564-97-4 — see every product listed under this CAS number, including other names
6-Bromo-8-methyl-2H-benzo(b)(1,4)oxazin-3(4H)-one, 98% (CAS 121564-97-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A607206-250mg |
| cas | 121564-97-4 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 499.66 Pln | |
| AmBeed | 25g | 13076.98 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-bromo-8-methyl-4H-1,4-benzoxazin-3-one (CAS 121564-97-4) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 6-bromo-8-methyl-4H-1,4-benzoxazin-3-one. InChIKey: PLKXHZTWQITWFD-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 6-bromo-8-methyl-4H-1,4-benzoxazin-3-one |
| InChIKey | PLKXHZTWQITWFD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1OCC(=O)N2)Br |
Computed by PubChem (NCBI)