cas: 121564-97-4 — see every product listed under this CAS number, including other names
6-Bromo-8-methyl-2H-benzo[b][1,4]oxazin-3(4H)-one, 98% (CAS 121564-97-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F339736-250MG |
| cas | 121564-97-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 518.59 Pln | |
| Fluorochem | 5g | 1830.62 Pln | |
| Fluorochem | 10g | 3324.89 Pln | |
| Fluorochem | 25g | 8151.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-bromo-8-methyl-4H-1,4-benzoxazin-3-one (CAS 121564-97-4) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 6-bromo-8-methyl-4H-1,4-benzoxazin-3-one. InChIKey: PLKXHZTWQITWFD-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 6-bromo-8-methyl-4H-1,4-benzoxazin-3-one |
| InChIKey | PLKXHZTWQITWFD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1OCC(=O)N2)Br |
Computed by PubChem (NCBI)