cas: 121564-97-4 — see every product listed under this CAS number, including other names
6-Bromo-8-methyl-2H-benzo[b][1,4]oxazin-3(4H)-one, 98%, 98% (CAS 121564-97-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 10g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1126AE-100mg |
| cas | 121564-97-4 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 1g | 448.40 Pln | |
| Chemat | 10g | 2944.40 Pln | |
| Chemat | 250mg | 270.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-bromo-8-methyl-4H-1,4-benzoxazin-3-one (CAS 121564-97-4) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 6-bromo-8-methyl-4H-1,4-benzoxazin-3-one. InChIKey: PLKXHZTWQITWFD-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 6-bromo-8-methyl-4H-1,4-benzoxazin-3-one |
| InChIKey | PLKXHZTWQITWFD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1OCC(=O)N2)Br |
Computed by PubChem (NCBI)