6-Chloro-5-methoxypyridine-3-sulfonyl chloride, 95%
cas: 75720-93-3 — see every product listed under this CAS number, including other names
6-Chloro-5-methoxypyridine-3-sulfonyl chloride, 95% (CAS 75720-93-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1039716-250mg |
| cas | 75720-93-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2206.00 Pln | |
| Ambeed | 1g | 5804.94 Pln | |
| Chemat | 50mg | 645.20 Pln | |
| Chemat | 100mg | 1048.40 Pln | |
| Chemat | 250mg | 2032.40 Pln | |
| Chemat | 1g | 5973.20 Pln | |
| BLDpharm | 50mg | 653.13 Pln | |
| BLDpharm | 100mg | 1058.54 Pln | |
| BLDpharm | 250mg | 2041.53 Pln | |
| BLDpharm | 1g | 5990.14 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-chloro-5-methoxypyridine-3-sulfonyl chloride (CAS 75720-93-3) is a chemical compound with the molecular formula C6H5Cl2NO3S and a molecular weight of 242.08 g/mol. IUPAC name: 6-chloro-5-methoxypyridine-3-sulfonyl chloride. InChIKey: CZEMPZCDNBZFKG-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO3S |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | 6-chloro-5-methoxypyridine-3-sulfonyl chloride |
| InChIKey | CZEMPZCDNBZFKG-UHFFFAOYSA-N |
| SMILES | COC1=C(N=CC(=C1)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)