6-Chloro-5-nitronicotinic acid, 98%
cas: 7477-10-3 — see every product listed under this CAS number, including other names
6-Chloro-5-nitronicotinic acid, 98% (CAS 7477-10-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg, 1kg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A102268-1g |
| cas | 7477-10-3 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 342.56 Pln | |
| Ambeed | 25g | 737.50 Pln | |
| Ambeed | 100g | 1911.19 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 150.80 Pln | |
| Chemat | 10g | 232.40 Pln | |
| Chemat | 100g | 1677.20 Pln | |
| Chemat | 1kg | 4605.20 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 231.05 Pln | |
| BLDpharm | 10g | 364.34 Pln | |
| BLDpharm | 25g | 786.41 Pln | |
| BLDpharm | 100g | 2058.19 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
6-chloro-5-nitropyridine-3-carboxylic acid (CAS 7477-10-3) is a chemical compound with the molecular formula C6H3ClN2O4 and a molecular weight of 202.55 g/mol. IUPAC name: 6-chloro-5-nitropyridine-3-carboxylic acid. InChIKey: HCRHNMXCDNACMH-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN2O4 |
|---|---|
| Molecular weight | 202.55 g/mol |
| IUPAC name | 6-chloro-5-nitropyridine-3-carboxylic acid |
| InChIKey | HCRHNMXCDNACMH-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1[N+](=O)[O-])Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
6-chloro-5-nitropyridine-3-carboxylic acid, 2-Chloro-3-nitro-5-pyridinecarboxylic acid, 3-Pyridinecarboxylicacid, 6-chloro-5-nitro-, 6-Chloro-5-nitro-nicotinic acid, Chloro-5-nitronicotinic acid, HCRHNMXCDNACMH-UHFFFAOYSA-N, 6-Chloro-5-nitronicotinic acid, AldrichCPR, 6-chloro-5-nitro-pyridine-3-carboxylic acid