CAS 42959-38-6 appears in our catalog under these names: 2-Chloro-5-nitronicotinic acid, 95%, 2–Chloro–5–nitronicotinic acid, 2-Chloro-5-nitronicotinic acid, 2-Chloro-5-nitronicotinic acid, ≥95%, ≥95%, 2-Chloro-5-nitronicotinic acid, >=95%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100g, 25g.
2-chloro-5-nitropyridine-3-carboxylic acid (CAS 42959-38-6) is a chemical compound with the molecular formula C6H3ClN2O4 and a molecular weight of 202.55 g/mol. IUPAC name: 2-chloro-5-nitropyridine-3-carboxylic acid. InChIKey: WOFZRBCITDVRON-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN2O4 |
|---|---|
| Molecular weight | 202.55 g/mol |
| IUPAC name | 2-chloro-5-nitropyridine-3-carboxylic acid |
| InChIKey | WOFZRBCITDVRON-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)