CAS 619-16-9 is the registry number for 2-chloro-1,4-dinitrobenzene. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 50mg.
2-chloro-1,4-dinitrobenzene (CAS 619-16-9) is a chemical compound with the molecular formula C6H3ClN2O4 and a molecular weight of 202.55 g/mol. IUPAC name: 2-chloro-1,4-dinitrobenzene. InChIKey: OEZJLUBWUDVTSS-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN2O4 |
|---|---|
| Molecular weight | 202.55 g/mol |
| IUPAC name | 2-chloro-1,4-dinitrobenzene |
| InChIKey | OEZJLUBWUDVTSS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)