CAS 1393569-52-2 is the registry number for 4-Chloro-6-Nitro-Picolinic Acid. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-6-nitropyridine-2-carboxylic acid (CAS 1393569-52-2) is a chemical compound with the molecular formula C6H3ClN2O4 and a molecular weight of 202.55 g/mol. IUPAC name: 4-chloro-6-nitropyridine-2-carboxylic acid. InChIKey: ZSCYJDMXFRUNJE-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN2O4 |
|---|---|
| Molecular weight | 202.55 g/mol |
| IUPAC name | 4-chloro-6-nitropyridine-2-carboxylic acid |
| InChIKey | ZSCYJDMXFRUNJE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(=O)O)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)