Products 1393569-52-2

CAS 1393569-52-2 is the registry number for 4-Chloro-6-Nitro-Picolinic Acid. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-chloro-6-nitropyridine-2-carboxylic acid (CAS 1393569-52-2) is a chemical compound with the molecular formula C6H3ClN2O4 and a molecular weight of 202.55 g/mol. IUPAC name: 4-chloro-6-nitropyridine-2-carboxylic acid. InChIKey: ZSCYJDMXFRUNJE-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3ClN2O4
Molecular weight202.55 g/mol
IUPAC name4-chloro-6-nitropyridine-2-carboxylic acid
InChIKeyZSCYJDMXFRUNJE-UHFFFAOYSA-N
SMILESC1=C(C=C(N=C1C(=O)O)[N+](=O)[O-])Cl

Computed by PubChem (NCBI)