CAS 618-86-0 is the registry number for 3,5-Dinitrochlorobenzene, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg.
1-chloro-3,5-dinitrobenzene (CAS 618-86-0) is a chemical compound with the molecular formula C6H3ClN2O4 and a molecular weight of 202.55 g/mol. IUPAC name: 1-chloro-3,5-dinitrobenzene. InChIKey: GFJKASVFAWFUNI-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN2O4 |
|---|---|
| Molecular weight | 202.55 g/mol |
| IUPAC name | 1-chloro-3,5-dinitrobenzene |
| InChIKey | GFJKASVFAWFUNI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)