Products 353281-15-9
CAS 353281-15-9 appears in our catalog under these names: 2–Chloro–3–nitroisonicotinic acid, 2-Chloro-3-nitropyridine-4-carboxylic acid, 2-Chloro-3-nitroisonicotinic acid 97%, 2-Chloro-3-Nitroisonicotinic Acid, 97%, 97%, 2-Chloro-3-nitroisonicotinic acid, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 100mg, 250mg, 10g, 250g.
2-chloro-3-nitropyridine-4-carboxylic acid (CAS 353281-15-9) is a chemical compound with the molecular formula C6H3ClN2O4 and a molecular weight of 202.55 g/mol. IUPAC name: 2-chloro-3-nitropyridine-4-carboxylic acid. InChIKey: ADPCJMUNRPBSCO-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN2O4 |
|---|---|
| Molecular weight | 202.55 g/mol |
| IUPAC name | 2-chloro-3-nitropyridine-4-carboxylic acid |
| InChIKey | ADPCJMUNRPBSCO-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(=O)O)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)