Products 159853-92-6
CAS 159853-92-6 is the registry number for 5-Chloropyrazine-2,3-dicarboxylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloropyrazine-2,3-dicarboxylic acid (CAS 159853-92-6) is a chemical compound with the molecular formula C6H3ClN2O4 and a molecular weight of 202.55 g/mol. IUPAC name: 5-chloropyrazine-2,3-dicarboxylic acid. InChIKey: HLUIDKPBRYGSBH-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN2O4 |
|---|---|
| Molecular weight | 202.55 g/mol |
| IUPAC name | 5-chloropyrazine-2,3-dicarboxylic acid |
| InChIKey | HLUIDKPBRYGSBH-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=N1)C(=O)O)C(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2,3-Pyrazinedicarboxylic acid, 5-chloro-