Products 882513-65-7
CAS 882513-65-7 is the registry number for 1-Chloro-2,4-dinitrobenzene- 13C6. Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 5mg.
1-chloro-2,4-dinitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (CAS 882513-65-7) is a chemical compound with the molecular formula C6H3ClN2O4 and a molecular weight of 208.51 g/mol. IUPAC name: 1-chloro-2,4-dinitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene. InChIKey: VYZAHLCBVHPDDF-IDEBNGHGSA-N.
| Molecular formula | C6H3ClN2O4 |
|---|---|
| Molecular weight | 208.51 g/mol |
| IUPAC name | 1-chloro-2,4-dinitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| InChIKey | VYZAHLCBVHPDDF-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13C]([13CH]=[13C]1[N+](=O)[O-])[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)
Synonyms:
1-Chloro-2,4-dinitrobenzene- 13C6