cas: 875305-42-3 — see every product listed under this CAS number, including other names
6-Fluoro-1H-indole-7-carboxylic acid 97% (CAS 875305-42-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A439277-100mg |
| cas | 875305-42-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 537.25 Pln | |
| Ambeed | 250mg | 843.19 Pln | |
| Ambeed | 1g | 2150.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A439277 |
6-fluoro-1H-indole-7-carboxylic acid (CAS 875305-42-3) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 6-fluoro-1H-indole-7-carboxylic acid. InChIKey: YJYWCXSCEPWZIV-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 6-fluoro-1H-indole-7-carboxylic acid |
| InChIKey | YJYWCXSCEPWZIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=CN2)C(=O)O)F |
Computed by PubChem (NCBI)