cas: 88754-96-5 — see every product listed under this CAS number, including other names
6-Fluoro-2-methyl-4-chromanone (CAS 88754-96-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F008563-250MG |
| cas | 88754-96-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 310.33 Pln |
| delivery time | 3-4 weeks |
|---|
6-fluoro-2-methyl-2,3-dihydrochromen-4-one (CAS 88754-96-5) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 6-fluoro-2-methyl-2,3-dihydrochromen-4-one. InChIKey: RPAIBTVEPAACRP-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 6-fluoro-2-methyl-2,3-dihydrochromen-4-one |
| InChIKey | RPAIBTVEPAACRP-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)C2=C(O1)C=CC(=C2)F |
Computed by PubChem (NCBI)