cas: 295779-82-7 — see every product listed under this CAS number, including other names
6-Fluoro-5-methoxy-2,3-dihydro-1H-inden-1-one 95% (CAS 295779-82-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A181886-100mg |
| cas | 295779-82-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 637.38 Pln | |
| Ambeed | 1g | 1277.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A181886 |
6-fluoro-5-methoxy-2,3-dihydroinden-1-one (CAS 295779-82-7) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 6-fluoro-5-methoxy-2,3-dihydroinden-1-one. InChIKey: UEAXBANALITWAP-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 6-fluoro-5-methoxy-2,3-dihydroinden-1-one |
| InChIKey | UEAXBANALITWAP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CCC2=O)F |
Computed by PubChem (NCBI)