cas: 116350-38-0 — see every product listed under this CAS number, including other names
6-Hydroxy-1H-indole-2-carboxylic acid methyl ester, 98%, 98% (CAS 116350-38-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111C0I-100mg |
| cas | 116350-38-0 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 558.80 Pln | |
| Chemat | 5g | 1802.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 6-hydroxy-1H-indole-2-carboxylate (CAS 116350-38-0) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: methyl 6-hydroxy-1H-indole-2-carboxylate. InChIKey: PFHGZEXEKZRMIP-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | methyl 6-hydroxy-1H-indole-2-carboxylate |
| InChIKey | PFHGZEXEKZRMIP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(N1)C=C(C=C2)O |
Computed by PubChem (NCBI)