cas: 116350-38-0 — see every product listed under this CAS number, including other names
Methyl 6-hydroxy-1H-indole-2-carboxylate 98% (CAS 116350-38-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A180713-100mg |
| cas | 116350-38-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 214.62 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 693.00 Pln | |
| Ambeed | 5g | 2267.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A180713 |
Methyl 6-hydroxy-1H-indole-2-carboxylate (CAS 116350-38-0) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: methyl 6-hydroxy-1H-indole-2-carboxylate. InChIKey: PFHGZEXEKZRMIP-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | methyl 6-hydroxy-1H-indole-2-carboxylate |
| InChIKey | PFHGZEXEKZRMIP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(N1)C=C(C=C2)O |
Computed by PubChem (NCBI)